are ratios 2:3 and 8:12 equalvelent to eachother

Answers

Answer 1

Answer:

2:3 is equal to 8:12

Step-by-step explanation:

2:3

To get the first number to 8

8/2 = 4

Multiply by all terms 4

2*3 : 3*4

8:12

2:3 is equal to 8:12

Answer 2

8:12 = 8/12

= 2/3

= 2:3

Therefore 2:3 and 8:12 are equalent to each other.

Answered by Gauthmath must click thanks and mark brainliest


Related Questions

Which of the following questions are equivalent to the answer below x 3/5

Answers

Answer:

[tex]x^\frac{3}{5} = (x^3 )^\frac{1}{5}[/tex]

[tex]x^\frac{3}{5} = \sqrt[5]{x^3}[/tex]

[tex]x^\frac{3}{5} = (\sqrt[5]{x})^3[/tex]

Step-by-step explanation:

Given

[tex]x^\frac{3}{5}[/tex]

Required

The equivalent expressions

We have:

[tex]x^\frac{3}{5}[/tex]

Expand the exponent

[tex]x^\frac{3}{5} = x^{ 3 * \frac{1}{5}}[/tex]

So, we have:

[tex]x^\frac{3}{5} = (x^3 )^\frac{1}{5}[/tex] ----- this is equivalent

Express 1/5 as roots (law of indices)

[tex]x^\frac{3}{5} = \sqrt[5]{x^3}[/tex] ------ this is equivalent

The above can be rewritten as:

[tex]x^\frac{3}{5} = (\sqrt[5]{x})^3[/tex] ------ this is equivalent

Please send only answer
Want to bring a metal rod to assemble a toy frame. All long metal rods must be used at least. How much to assemble the frame as shown in the picture

Answers

Answer:

how many times should u use the metal rod ??

What is the value of x in the equation 5(3x + 4) = 23?

Answers

Answer:

x = 1/5

Step-by-step explanation:

5(3x + 4) = 23

Distribute

15x+20 = 23

Subtract 20 from each side

15x+20-20 = 23-20

15x = 3

Divide by 15

15x/15 = 3/15

x = 1/5

Answer:

[tex]x = 0.2[/tex]

Step-by-step explanation:

Step 1:  Distribute

[tex]5(3x + 4) = 23[/tex]

[tex](5 * 3x) + (5 * 4) = 23[/tex]

[tex](15x) + 20 = 23[/tex]

Step 2:  Subtract 20 from both sides

[tex](15x) + 20 - 20 = 23 - 20[/tex]

[tex]15x = 3[/tex]

Step 3:  Divide both sides by 15

[tex]\frac{15x}{15} = \frac{3}{15}[/tex]

[tex]x = \frac{1}{5}[/tex]

[tex]x = 0.2[/tex]

Answer:  [tex]x = 0.2[/tex]

Help me! Thanks!!!!!!

Answers

Answer:

there are infinite solutions

Step-by-step explanation:

if you add y-3 to both sides of the first equation, you will see that it is equal to the second equation, so they are the same line. Therefore, there are infinite solutions to this system

Enter the solutions from least to greatest.
f(x) = (x – 3)(2x – 8)

Answers

Answer:

The zeroes of the function are: 3 and 4

Step-by-step explanation:

Use the integral test to determine whether the series is convergent or divergent. [infinity] n = 2 n2 n3 + 1 Evaluate the following integral. [infinity] 2 x2 x3 + 1 dx

Answers

I think the given series is

[tex]\displaystyle\sum_{n=2}^\infty \frac{n^2}{n^3+1}[/tex]

You can use the integral test because the summand is clearly positive and decreasing. Then

[tex]\displaystyle\sum_{n=2}^\infty\frac{n^2}{n^3+1} > \int_2^\infty\frac{x^2}{x^3+1}\,\mathrm dx[/tex]

Substitute u = x ³ + 1 and du = 3x ² dx, so the integral becomes

[tex]\displaystyle \int_2^\infty\frac{x^2}{x^3+1}\,\mathrm dx = \frac13\int_9^\infty\frac{\mathrm du}u = \frac13\ln(u)\bigg|_{u=9}^{u\to\infty}[/tex]

As u approaches infinity, we have ln(u) also approaching infinity (whereas 1/3 ln(9) is finite), so the integral and hence the sum diverges.

Please help I need the answer ASAP!!

Answers

The hypotenuse will always be the longest side of the triangle. Option C is correct: AB > DC.

AB is the hypotenuse of triangle ABC. Therefore, it is greater than leg AC. AC is the hypotenuse of triangle ACD. If AC is less than AB, then DC must also be less than AB because DC is less than AC.

Hope this helps!

–20 ÷ 5 =

I need help

Answers

The answer is -4
-20 divided by 5 ^

g A gift shop sells 40 wind chimes per month at $110 each. The owners estimate that for each $11 increase in price, they will sell 2 fewer wind chimes per month. Find the price per wind chime that will maximize revenue.

Answers

Answer:

The price that maximizes the revenue is $165

Step-by-step explanation:

We can model the price as a function of sold units as a linear relationship.

Remember that a linear relationship is something like:

y = a*x + b

where a is the slope and b is the y-intercept.

We know that if the line passes through the points (x₁, y₁) and (x₂, y₂), then the slope can be written as:

a = (y₂ - y₁)/(x₂ - x₁)

For this line, we have the point (40, $110)

which means that to sell 40 units, the price must be $110

And we know that if the price increases by $11, then he will sell 2 units less.

Then we also have the point (38, $121)

So we know that our line passes through the points (40, $110) and  (38, $121)

Then the slope of the line is:

a = ($121 - $110)/(38 - 40) = $11/-2 = -$5.5

Then the equation of the line is:

p(x) = -$5.5*x + b

to find the value of b, we can use the point (40, $110)

This means that when x = 40, the price is $110

then:

p(40) = $110 = -$5.5*40 + b

            $110 = -$220 + b

       $110 + $220 = b

        $330 = b

Then the price equation is:

p(x) = -$5.5*x + $330

Now we want to find the maximum revenue.

The revenue for selling x items, each at the price p(x), is:

revenue = x*p(x)

replacing the p(x) by the equation we get:

revenue = x*(-$5.5*x + $330)

revenue = -$5.5*x^2 + $330*x

Now we want to find the x-value for the maximum revenue.

You can see that the revenue equation is a quadratic equation with a negative leading coefficient. This means that the maximum is at the vertex.

And remember that for a quadratic equation like:

y = a*x^2 + b*x + c

the x-value of the vertex is:

x = -b/2a

Then for our equation:

revenue = -$5.5*x^2 + $330*x

the x-vale of the vertex will be:

x = -$330/(2*-$5.5) = 30

x = 30

This means that the revenue is maximized when we sell 30 units.

And the price is p(x) evaluated in x = 30

p(30) = -$5.5*30 + $330 = $165

The price that maximizes the revenue is $165

Calculate the break even sales dollars if the fixed expenses are $7,000 and the contribution ratio is 40%.

Answers

Answer:

Break even sales = $17,500 (Approx.)

Step-by-step explanation:

Given:

Fixed expenses = $7,000

Contribution ratio = 40%

Find:

Break even sales dollars

Computation:

Break even sales = Fixed expenses / Contribution ratio

Break even sales = 7,000 / 40%

Break even sales = 7,000 / 0.40

Break even sales = 17,500

Break even sales = $17,500 (Approx.)

Trucks in a delivery fleet travel a mean of 120 miles per day with a standard deviation of 23 miles per day. The mileage per day is distributed normally. Find the probability that a truck drives less than 159 miles in a day. Round your answer to four decimal places.

Answers

Answer:

the probability that a truck drives less than 159 miles in a day = 0.9374

Step-by-step explanation:

Given;

mean of the truck's speed, (m) = 120 miles per day

standard deviation, d = 23 miles per day

If the mileage per day is normally distributed, we use the following conceptual method to determine the probability of less than 159 miles per day;

1 standard deviation above the mean = m + d, = 120 + 23 = 143

2 standard deviation above the mean = m + 2d, = 120 + 46 = 166

159 is below 2 standard deviation above the mean but greater than 1 standard deviation above the mean.

For normal districution, 1 standard deviation above the mean = 84 percentile

Also, 2 standard deviation above the mean = 98 percentile

143 --------> 84%

159 ---------> x

166 --------- 98%

[tex]\frac{159-143}{166-143} = \frac{x-84}{98-84} \\\\\frac{16}{23} = \frac{x-84}{14} \\\\23(x-84) = 224\\\\x-84 = 9.7391\\\\x = 93.7391\ \%[/tex]

Therefore, the probability that a truck drives less than 159 miles in a day = 0.9374


I need help answering this ASAP

Answers

Answer:

A

Step-by-step explanation:

The graph is a square root function

find the equation of straight line passes through point (3,1) such that the intercept on y-axis exceeds that on the x- axis by 4.



Answers

Answer:

Step-by-step explanation:

Assume a researcher wants to compare the mean Alanine Aminotransferase (ALT) levels in two populations, individuals who drink alcohol and individuals who do not drink alcohol. The mean ALT levels for the individuals who do not drink alcohol is 32 with a standard deviation of 14, and 37 individuals were in the sample. The mean ALT levels for individuals who drink alcohol is 69 with a standard deviation of 19, and 38 individuals were in the sample. Construct and interpret a 95% confidence interval demonstrating the difference in means for those individuals who drink alcohol when compared to those who do not drink alcohol.
a. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.22 and 39.78.
b. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.33 and 39.67
c. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.32 and 39.68.
d. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.41 and 39.59.

Answers

Answer:

c. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.32 and 39.68.

Step-by-step explanation:

Given :

Groups:

x1 = 69 ; s1 = 19 ; n1 = 38

x2 = 32 ; s2 = 14 ; n2 = 37

1 - α = 1 - 0.95 = 0.05

Using a confidence interval calculator to save computation time, kindly plug the values into the calculator :

The confidence interval obtained is :

(24.32 ; 39.68) ; This means that we are 95% confident that the true mean difference in ALT values between the two population lies between

(24.32 ; 39.68) .

How would the following triangle be classified?
O scalene acute
O scalene obtuse
O isosceles acute
O isosceles obtuse

Answers

Answer:

isosceles acute

Step-by-step explanation:

We have two sides that are equal so the triangle is isosceles

None of the angles are larger than 90 degrees so non of the angles are obtuse,  and none of the angles are 90 degrees, so the triangle is acute ( which means the angles are all less than 90 degrees)

.
.
.
.
.
.
.
.
.
.
.
“””” HELP PLEASE “”””
.
.
.
.
.
.
.
.
.
.
.

Answers

9514 1404 393

Answer:

  x = 14 cm

Step-by-step explanation:

We can only solve for x if the triangles are similar. The arrows on the left and right legs say those are parallel. Since alternate interior angles at each of the transversals are congruent, the triangles are AA similar.

ΔABC ~ ΔDEC, so we have ...

  EC/ED = BC/BA

  x/(18 cm) = (35 cm)/(45 cm)

  x = (18 cm)(7/9) = 14 cm

PLEASE HELP ASAP!!!!!

Answers

Step-by-step explanation:

Area ABC=1/2ab×sin C

=1/2 ×20×10 ×Sin C

Sin C =100

Help me please and thank you

Answers

Answer:

D) 0.89

Step-by-step explanation:

round 0.885 to 0.89

sin(180+0).cos(180+0)/cos(180+0).sin(180-0)​

Answers

Sin(180+0).cos(180+0) = 0.479458
Cos(180+0).sin(180-0) = 0.479458
Final answer is = 1
Hope that help

find the two intersection points

(x+1)^2 +(y+2)^2 = 16

3x+ 4y = 1
Show your steps please

Answers

Answer:

Our two intersection points are:

[tex]\displaystyle (3, -2) \text{ and } \left(-\frac{53}{25}, \frac{46}{25}\right)[/tex]

Step-by-step explanation:

We want to find where the two graphs given by the equations:

[tex]\displaystyle (x+1)^2+(y+2)^2 = 16\text{ and } 3x+4y=1[/tex]

Intersect.

When they intersect, their x- and y-values are equivalent. So, we can solve one equation for y and substitute it into the other and solve for x.

Since the linear equation is easier to solve, solve it for y:

[tex]\displaystyle y = -\frac{3}{4} x + \frac{1}{4}[/tex]

Substitute this into the first equation:

[tex]\displaystyle (x+1)^2 + \left(\left(-\frac{3}{4}x + \frac{1}{4}\right) +2\right)^2 = 16[/tex]

Simplify:

[tex]\displaystyle (x+1)^2 + \left(-\frac{3}{4} x + \frac{9}{4}\right)^2 = 16[/tex]

Square. We can use the perfect square trinomial pattern:

[tex]\displaystyle \underbrace{(x^2 + 2x+1)}_{(a+b)^2=a^2+2ab+b^2} + \underbrace{\left(\frac{9}{16}x^2-\frac{27}{8}x+\frac{81}{16}\right)}_{(a+b)^2=a^2+2ab+b^2} = 16[/tex]

Multiply both sides by 16:

[tex](16x^2+32x+16)+(9x^2-54x+81) = 256[/tex]

Combine like terms:

[tex]25x^2+-22x+97=256[/tex]

Isolate the equation:

[tex]\displaystyle 25x^2 - 22x -159=0[/tex]

We can use the quadratic formula:

[tex]\displaystyle x = \frac{-b\pm\sqrt{b^2-4ac}}{2a}[/tex]

In this case, a = 25, b = -22, and c = -159. Substitute:

[tex]\displaystyle x = \frac{-(-22)\pm\sqrt{(-22)^2-4(25)(-159)}}{2(25)}[/tex]

Evaluate:

[tex]\displaystyle \begin{aligned} x &= \frac{22\pm\sqrt{16384}}{50} \\ \\ &= \frac{22\pm 128}{50}\\ \\ &=\frac{11\pm 64}{25}\end{aligned}[/tex]

Hence, our two solutions are:

[tex]\displaystyle x_1 = \frac{11+64}{25} = 3\text{ and } x_2 = \frac{11-64}{25} =-\frac{53}{25}[/tex]

We have our two x-coordinates.

To find the y-coordinates, we can simply substitute it into the linear equation and evaluate. Thus:

[tex]\displaystyle y_1 = -\frac{3}{4}(3)+\frac{1}{4} = -2[/tex]

And:

[tex]\displaystyle y _2 = -\frac{3}{4}\left(-\frac{53}{25}\right) +\frac{1}{4} = \frac{46}{25}[/tex]

Thus, our two intersection points are:

[tex]\displaystyle (3, -2) \text{ and } \left(-\frac{53}{25}, \frac{46}{25}\right)[/tex]

rope price of length 45cm 25 cm and 81 cm have to be cut into same size pieces what is the smallest price length possible​

Answers

= 2025

When you are told to find the smallest length possible, you perform L.C.M(Least common multiples)

For this, you divide the given lengths using the numbers that divides all through.

I have added an image to this answer. Go through it for more explanation

Two chords in a circle intersect. One chord is made of 6 and 5, and the other is made of x +1 and x. What is x?

Answers

Answer:

x = 5 and -6

Step-by-step explanation:

Using the intersecting chord theorem which states that the products of the lengths of the line segments on each chord are equal.

Hence:

let

a = 6, b = 5, c = x+1 and d = x

Therefore, ab = cd

6*5 = x(x+1)

30 = x²+x

x²+x - 30 = 0

x²+ 6x - 5x - 30 = 0

x(x+6) - 5(x+6) =0

(x-5)(x+6) = 0

x-5 =0 and x+6 = 0

x = 5 and -6

18. A triangle has side lengths of 6, 8, and 9. What type of triangle is it?

acute

obtuse

equiangular

right

Answers

Answer:

obtuse                    

aniuhafjhnfajfnha

1. You are given the 3rd and 5th term of an arithmetic sequence. Describe in words how to determine the general term.

2. You are given the 3rd and 5th term of an geometric sequence. Describe how to determine the 10th term without finding the general term.

Answers

Step-by-step explanation:

1. In an arithmetic sequence, the general term can be written as

xₙ = y + d(a-1), where xₐ represents the ath term, y is the first value, and d is the common difference.

Given the third term and the fifth term, and knowing that the difference between each term is d, we can say that the 4th term is x₃+d and the fifth term is the fourth term plus d, or (x₃+d)+d =

x₃+2d. =x₅ Given x₃ and x₅, we can subtract x₃ from both sides to get

x₅-x₃ = 2d

divide by 2 to isolate d

(x₅-x₃)/2 = d

This lets us solve for d. Given d, we can say that

x₃ = y+d(2)

subtract 2*d from both sides to isolate the y

x₃ -2*d = y

Therefore, because we know x₃ and d at this point, we can solve for y, letting us plug y and d into our original equation of

xₙ = y + d(a-1)

2.

Given the third and fifth term, with a common ratio of r, we can say that the fourth term is x₃ * r. Then, the fifth term is

x₃* r * r

= x₃*r² = x₅

divide both sides by x₃ to isolate the r²

x₅/x₃ = r²

square root both sides

√(x₅/x₃) = ±r

One thing that is important to note is that we don't know whether r is positive or negative. For example, if x₃ = 4 and x₅ = 16, regardless of whether r is equal to 2 or -2, 4*r² = 16. I will be assuming that r is positive for this question.

Given the common ratio, we can find x₆ as x₅ * r, x₇ as x₅*r², and all the way up to x₁₀ = x₅*r⁵. We don't know the general term, but can still find the tenth term of the sequence

Using the following system of equations to help, what is the value of x-2y?
3x + 2y =48
2x +3y =12
Please help.

Answers

X - Y = 36 -> X = 36+ Y
3X + 2Y = 48 -> 3(36+Y)+2Y= 48-> Y = -12
X = 36-12= 24
X -2Y= 24-2.(-12) = 48

What is the distance between the points (7, 8) and (-8, 0) on a coordinate grid?

Answers

Answer:

17 units

Step-by-step explanation:

Use the distance formula, [tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]

Plug in the points and simplify:

[tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]

[tex]d = \sqrt{(-8 - 7)^2 + (0-8)^2}[/tex]

[tex]d = \sqrt{(-15)^2 + (-8)^2}[/tex]

[tex]d = \sqrt{225 + 64[/tex]

[tex]d = \sqrt{289[/tex]

[tex]d = 17[/tex]

So, the distance between the points is 17 units

Two cars start moving from the same point. One travels south at 24 mi/h and the other travels west at 18 mi/h. At what rate (in mi/h) is the distance between the cars increasing two hours later

Answers

Answer:

The rate at which the distance between the two cars is increasing is 30 mi/h

Step-by-step explanation:

Given;

speed of the first car, v₁ = 24 mi/h

speed of the second car, v₂ = 18 mi/h

Two hours later, the position of the cars is calculated as;

position of the first car, d₁ = 24 mi/h  x 2 h  = 48 mi

position of the second car, d₂ = 18 mi/h  x 2 h = 36 mi

The displacement of the two car is calculated as;

displacement, d² = 48² + 36²

                        d² = 3600

                        d = √3600

                        d = 60 mi

The rate at which this displacement is changing = (60 mi) / (2h)

                                                                                 = 30 mi/h

The function below models the correlation between the number of hours a plant is kept in sunlight (x) and the height (y), in mm, to which it grows: y = 2 + 4x What does the y-intercept of this function represent? (1 point) The original height of the plant was 4 mm. The original height of the plant was 2 mm. The height of the plant increases by 2 mm for every hour of sunlight it receives. The height of the plant increases by 4 mm for every hour of sunlight it receives.

Answers

Answer:

The original height of the plant was 2 mm

Step-by-step explanation:

Given

[tex]y = 2 + 4x[/tex]

Required

Interpret the y-intercept

The y-intercept is when [tex]x = 0[/tex]

So, we have:

[tex]y = 2 + 4 *0[/tex]

[tex]y = 2 + 0[/tex]

[tex]y = 2[/tex]

This implies that the original or initial height was 2 mm

find the missing side length below brainly

Answers

Let it be x

[tex]\\ \sf\longmapsto \dfrac{3}{5}=\dfrac{x}{x+4}[/tex]

[tex]\\ \sf\longmapsto 3(x+4)=5x[/tex]

[tex]\\ \sf\longmapsto 3x+12=5x[/tex]

[tex]\\ \sf\longmapsto 5x-3x=12[/tex]

[tex]\\ \sf\longmapsto 2x=12[/tex]

[tex]\\ \sf\longmapsto x=\dfrac{12}{2}[/tex]

[tex]\\ \sf\longmapsto x=6[/tex]

a coin is tossed succesively three times times . determine tje probabiliy of getting all three heads​

Answers

Answer:

Answer : 1/8.

Step-by-step explanation:

Hey there!

Please see the attached picture for your answer.

Hope it helps!

Other Questions
Explain any three causes for the disappearance of forests in Eastern India during the British rule. Find the area of sector TOP in (O using the given information. Leave youranswer in terms of .13. r = 5 m, m = 90 degrees Is "freedom from fear" a concern for both men and women equally? What is the best strategy for overcoming language barriers at work? a) constantly ask people to repeat what they have said b) speak loudly and quickly c) speak slowly and clearly d) stick to one channel of communication find the length of side x to the nearest tenth 36. My best friend doesnt go to school yesterday. My best friend was _______________________________________________________________ 37. I dont like pork. My sister doesnt like pork, either. I dont like pork. Neither___________________________________________________________ 38. I use a cassette to practice listening skills. A cassette _______________________________________________________________________ 39. Im very keen on joining the rock concert next Sunday. Im looking _____________________________________________________________________40. Marys mother said to her, Bring your raincoat along when you leave home today. Marys mother asked ______________________________________________________________41. Lan said to Quan, How often does your sister go to the zoo? Lan asked _______________________________________________________________________ 42. Henrys success is his parents pride. Henrys parents are ________________________________________________________________ Being an effective member of a team means each team member has the same a) personalities. b) responsibilities. O c) strengths. d) goals. the pH value of 0.1 mol dm-3 of acid U is 1. Which statement is true about acid U?A) slightly soluble in water B) reacts only with a weak alkaliC) the degree of ionization in water is high D) has a low concentration of hydrogen ions In remodeling a house an architect finds that by adding the same amount to each dimension of a 15ft by 19ft rectangular room, the area would be increased by 98 ft^2. Howmuch must be added to each dimension?Let x be the amount that is added to each dimension. After writing an equation in standard form with a > 0, a= ? b= ? and c= ?(Simplify your answers.) What is the approximate volume of thepyramid if the base area is 625 squarefeet and the height is 50 feet? Assuming that a person going to community college can't afford to go to a four-year college is an example of ) a generalization. b) discrimination. O c) a stereotype. O d) tolerance. Which graph represents a decreasing trend URGENT PLS HELP. pls put explanation as well thank you:) What's a legal description? Unset starred question A description of the land that specifies the boundaries and location of a specific piece of real property An object used as a boundary or starting point for a metes and bounds description A professional, on-site measurement of the lot lines and dimensions of a property, including the location of any improvements (such as a house) on the lot, any encroachments that may exist, and any easements of public record The street address of a property, including the city, state, and zip code (also known as a "mailing address") Three friends go grocery shopping together, and each buys the same kind ofstrawberries. Akio buys 2 pounds (lb) and pays $3,50. Gordon buys 3 poundsand pays $5.25. Maria buys 4 pounds and pays $7.00,Identify the graph and unit price that represent the strawberry costs.Unit PriceA. $1.75 1lbb. $3.00 1lbthe bottom two are the same but with more space between the lines and they go up to 24c $3.00 1lbd. $1.75 1lb Which of the following behaviors would best describe someone who is listening and paying attention? a) Leaning toward the speaker O b) Interrupting the speaker to share their opinion c) Avoiding eye contact d) Asking questions to make sure they understand what's being said Why do you think American writers of subsequent literary periods often choose tobreak from traditions and seek more freedom in their artistic expressione Arewriters justified in challenging the artistic status quo? Why or why not? (Will give brainliest)A candy company claims that their bags of jellybeans have a mean weight of 9.45 oz. 125 randomly chosen bags of jellybeans were sampled, and it was discovered that their mean weight was 9.68 oz, with a standard deviation of 1.23 oz. Test this hypothesis using a 99% confidence level.A- Reject the null hypothesis. There is not enough evidence to oppose the company's claim.B- Reject the null hypothesis. There is enough evidence to oppose the company's claim.C- Fail to reject the null hypothesis. There is not enough evidence to oppose the company's claim.D- Fail to reject the null hypothesis. There is enough evidence to oppose the company's claim. Choose one of the options and fill in the blank.chemical energyskeletalcardiacsmoothfood and nutrientsexercisestriations or contractionsMovement is caused by __________________ of muscular tissue. The information necessary to conduct a bottom-up estimate of project time and cost starts with the ___________. Multiple Choice work package level 5 elements of the PBS milestones level 4 elements of the WBS planning horizon