The characteristics “fingerprints” of light produced when a substance is given energy are called…
A. Groundlings
B. Quantums
C. Spectrums
D. Amplitudes

Answers

Answer 1

A spectrum is a  pattern is unique to a substance and can be used identify it.

According to Max Plank, energy occurs in packets called quanta. Hence, energy is not continuous but takes on discrete values which are integer multiples of a fundamental amount.

Again, when a substance is given light energy, a characteristic fingerprint is obtained. This pattern is unique to the substance that has it. These characteristics “fingerprints” are called spectrums.

Learn more: https://brainly.com/question/6284546


Related Questions

How to write a chemical formula ?​

Answers

Answer:

To write a chemical equation, the reactants should be written on the left, and the products should be written on the right and the coefficients should be written next to the symbols of entities to indicate the number of moles of a substance produced used in the chemical reaction.

Solve pls brainliest
The two green substances are not same thing because some of their properties are different and some of them are the same. If they were the same substance, all of their properties would have to be the same.


How could the explanation be improved?

Answers

Answer:

Even though the two substances possess many similarities, they have some unique properties. In turn, since they have the same properties, if they were the same substance, it would make matters worse, if the same chemical was in two different places, there would not be a difference between them since they are the same, just as it is with are two different chemicals would have differing properties since they are two properties would vary from one another since they are 2 totally different things!

Hey can anyone pls answer dis in ur own wordssss

Answers

Answer: sorry

Explanation:

j

1. Why do you think the map is labeled "Three Sisters”?

also, i know this isn’t chemistry but i couldn’t find Earth Science so don’t come for me . i would appreciate it if y’all could help me the best you can!

Answers

Answer:

It's called the “The Three Sisters” because it comes from an Iroquois legend. The Legend says corn, beans and squash are inseparable sisters that were given to the people by the “Great Spirit.” It is important to note, however, that the “Three sisters” are also found in many other areas and tribes around North America.

Why are polyatomic called radicals

Answers

that’s because when a charged chemical species composes of two or more atoms (covalently bonded), they act as a single unit. the term radicals refers to free radicals that are with an unpaired electron and because not all of its electrons are found in pairs

A student dissolves ethanol (C2H5OH) in distilled water. In another container, he dissolves CaCl2, in distilled water. Will either of the solutions conduct electricity? If so which one?

Plz Help!

Answers

Answer: The CaCl2 solution will conduct electricity.

Answer:

i think that the  CaCl2 solution will conduct electricity

Explanation:

im not sure but if im wrong im sorry


c) A substance has a high melting point and conducts electricity. What type of structure does it have

Answers

Answer:

Metallic structure

Explanation:

They have a high melting point due to the strong forces of attraction between the positive ions (cations) and the delocalised electrons. Moreover, they conduct electricity due to the sea of delocalised electrons.

[Extra: It could be an ionic compound since they also have a high melting point, however they only conduct electricity in liquid or aqeouus state.]

1. Why are the world’s rainforests so important?




2. Predict solutions for slowing the loss of biodiversity.



3. Describe three ways humans are contributing to the loss of biodiversity.





4. How does the introduction of invasive, non-native species, threaten biodiversity?

Answers

Answer:

1.

Rainforests are important due to the amount of oxygen the tree's produce. It also adds biodiversity and more balance in the food chain of animals.

2.

If we slowed transportation and agricultural farming, greenhouse gases and carbon monoxide would be reduced magnificently.

3.

One way is that Humans are supplying demand for animal agriculture for food (when not need to). The greenhouse gases created by the factories alone are creating much of the ozone's destruction. Also, another reaction to demand of meat is, The space needed for farmland. They burn down much of the rainforest for farmland and grass for the cows and other animals. Thirdly, traveling alone and having many household luxuries aren't helping either. Lowering the use of composite resources and more wind, solar, and water energy can help the earth in total.

4.

Introducing invasive species endangers many of the other species. They could have a advantage or disadvantage over the other species. causing either over, or under, population for many of the species. Throwing the balance of it all off.

What eats a FawnsFoot Mussel?

Answers

Answer:

I have no Idea please give more context to your question.

Explanation:

the name of element P​

Answers

Answer:

phosphorus

Explanation:

mark me brainliest pl

How does the equation F= ma tell you that it is easier to push a small chair than a large couch
across the floor?

Answers

Explanation:

[tex] \boxed{ \mathsf{F = ma}}[/tex]

The Newton's Second law of motion, also known as The Law of mass and acceleration, derives the given equation in terms of mass, acceleration and force.

It actually states that Force applied on a body is equal to the time rate of change of it's momentum.

Momentum of a body, is the product of it's mass and velocity with which its moving.

This clarifies that objects at rest have zero momentum since they have zero velocity.

If a "source" applies force on an object, it's magnitude would depend on its rate of change of momentum with time.

Since, mass of an object is a fixed entity, so change in momentum would be caused due to change in velocity.

Now, if we happen to have two objects of different mass,

(As, in here, a chair and a large couch) and we have to push them so as to produce the same change in momentum, the force applied on a couch would be more than that applied on the chair.

Answer:

This is simply because,

Force = mass × acceleration

If acceleration for both the objects is fixed, the force applied differs due to theur difference in mass.

Note here that Force I'd directly proportional to mass.

The greater the mass is, the higher is the force required to produce same acceleration.

Thus, objects with higher mass will require a greater amount of force to have the same acceleration as the object of light weight.

Which of the following outcomes is a benefit of conventional agriculture?

Answers

Answer:

Preserving soil, water and energy resources has enabled modern farming to grow food sustainably on the same land for more than 100 years. ... Modern, conventional agriculture has key sustainability benefits in terms of land use, reduced soil erosion and water protection.

Explanation:

hope it helps you

Help me please…………..d

Answers

This is a double replacement reaction

Explain how wind and water can create a sand dune along an ocean beach

Answers

Answer: A dune is a mound of sand formed by the wind, usually along the beach or in a desert.  Dunes can also be formed by strong currents beneath the water.

FOR THE LOVE OF GOD SOMEONE PLEASE HELP ME
WHAT IS THE OXIDATION NUMBER OF THE S IN SO^-2 ???

Answers

Answer:

The oxidation number for sulfur in SO2 is +4.

Explanation:

To find the oxidation number of sulfur, it is simply a matter of using the formula SO2 and writing the oxidation numbers as S = (x) and O2 = 2(-2) = -4. Using the rule and adding the oxidation numbers in the compound, the equation becomes x +(-4 ) = 0. Solving for x, it is evident that the oxidation number for sulfur is +4.

what are three physical properties with constant value​

Answers

Answer: Certain physical constants (e.g., melting point, boiling point, density, refractivity, solubility) can be found in the literature for many compounds, whereas others (e.g., specific rotation) are characteristic of different groups of compounds and are known for almost all of them.

Explanation:

If the pressure, volume, and temperature of a gas are known, which can most likely be found by using the ideal gas law?
the molar amount of the gas
the partial pressure of the gas
the standard temperature and pressure
the molar mass

Answers

the correct answer should be: the molar amount of the gas.

Answer:

the molar amount of the gas.

Explanation:

What is the formula for the compound?

Answers

Answer:

the correct answer is CO2 (the last one)

I think the answer is CO2, I hope that helps

how do I know which substance is being reduced? ​

Answers

when an atoms oxidation number decreases in a reaction then it’s being reduced. the answer for that question is B

3 examples of how you think cells work in living things.

Answers

Answer:

Cells help the human body in many ways, Red or white blood cells are very important and are commonly spoken when bringing up cells. Plants have cells as well plant cells have special organelles called chloroplasts, which create sugars also known as photosynthesis.

Explanation:

idrk if that helped much-

help me please i dont understand

Answers

Answer:

1. Dissolving powder in milk - Chemical

  - It is chemical because the milk has changed on a molecular level

2. Toasting bread - Chemical

   - It is chemical because adding heat to the bread cooks it, therefore

     changing it on a molecular level

3. Melting cheese - Physical

   - It is physical because the physical appearance was the only change

4. Slicing apples or bannanas - Physical

   - It is physical because the physical appearance was the only change

5. Frying an egg - Chemical

   - It is chemical because new particles were formed

6. Milk souring - Chemical

   -  It is chemical because it is forming a new product (lactic acid)

Explanation:

Physical Change occurs when the particles of a substance become rearranged, but do not change into different particles.  

Chemical change occurs when a new substance is formed. This process is irreversable.

Answer:

give the preson above brainly bc there right

Explanation:

RNA is a double strand. True or False?

Answers

Answer:

False, RNA is single stranded, DNA is double stranded and forms a double helix

Explanation:

the ____ changes when electrons are gained or lost.

Answers

Answer: Matter changes when electrons are gained or lost.

Explanation:

The charge on an atom  changes when electrons are gained or lost during chemical changes.

What is an atom?

An atom is defined as the smallest unit of matter which forms an element. Every form of matter whether it is  solid,liquid , gas consists of atoms . Each atom has a nucleus which is composed of protons and neutrons and shells in which the electrons revolve.

The protons are positively charged  particles and neutrons are neutral and hence the nucleus is positively charged. The electrons which revolve around the nucleus are negatively charged and hence the atom as a whole is neutral  species and stable due to presence of oppositely charged particles.

Atoms of the same element are similar as they have number of sub- atomic particles which on combination do not alter the chemical properties of the substances.

Learn more about atom,here:

https://brainly.com/question/13654549

#SPJ6

why do atoms get smaller as you move across a period

Answers

Neutral atoms get smaller as you move across the periodic table from (left to right) because the atom increases in electrons. The more electrons, the bigger the effective nuclear charge (electron and proton attraction) and so basically the atom shrinks.

Analyze the reaction of solid magnesium and water. Which pair of reactants and products in the table below represent the correct balanced equation for the reaction?

Answers

Answer:

3 is correct answer I think

Explanation:

Labor unions arose in the nineteenth century as increasing numbers of Americans took jobs in factories, mines, and mills in the growing industrial economy.

The Knights of Labor, founded in 1869, was the first major labor organization in the United States. The Knights organized unskilled and skilled workers, campaigned for an eight hour workday, and aspired to form a cooperative society in which laborers owned the industries in which they worked.

The Knights’ membership collapsed following the 1886 Haymarket Square riot in Chicago. By 1886 the American Federation of Labor (AFL), an alliance of skilled workers’ trade unions, was growing.

what’s chemical formula ammonium iodide?

Answers

Answer:

NH4I

..................

I hope it helps

Answer:Ammonium Iodide is a chemical compound with a formula Explanation: nh4l

two samples of solids have similar reactivity with acids and similar densities. their masses and volumes, however, are not at all similar. is it possible that these are the same substance?

Answers

Given that the volume and mass of a substance are not defining properties, it is entirely possible for two samples with different volumes and mass to be the same substance.

What are defining properties of a substance?These are properties that can help us to identify a substance. The most useful of which tend to be chemical properties such as reactiveness or melting points. Colors and density can also offer the insight needed to identify elements and substances. Mass and volume are not properties of a substance given that they can change often depending on the sample size and thus do not help to identify a substance.

Therefore, since the volume and mass of a substance are not defining properties of a substance, we can confirm that it is entirely possible for two samples with different volumes and mass to be the same substance.

To learn more about properties of elements visit:

https://brainly.com/question/11838894?referrer=searchResults

Enter the correct ground-state (or lowest energy) configuration based on the number of electrons: 1s^2 2s^2 2p^6 3s^2 3p^6 3d^10.

Answers

Answer:

FIGURE 5.9 The arrow shows a second way of remembering the order in which sublevels fill. Table 5.2 shows the electron configurations of the elements with atomic numbers 1 through 18.

Element Atomic number Electron configuration

sulfur 16 1s22s22p63s23p4

chlorine 17 1s22s22p63s23p5

argon 18 1s22s22p63s23p6

Explanation:

Brainlilest me

Which statement is correct about charges?
A.Opposite charges repel
B.Similar charges attract
C.Electrons are positively charged
D.Similar charges repel

Answers

Answer:

A.Opposite charges repel

[tex] \: \: \: \: [/tex]

D.Similar charges repel

correct me if I'm wrong

hope it helps

What is the formula for atomic weight amu of neon

Answers

Answer:

abundance of the first isotope times the Mass of the first isotope

Other Questions
Find the length of the side and area ot the square whose perimeter is given below a)44cm b)80cm Please help me ?!!!!!!! Economic development isn't itselt an overall development. Justify this statement Using the following system of equations to help, what is the value of x-2y? 3x + 2y =48 2x +3y =12 Please help. HELP!!!!!!!!!!!!!!!!!two reasons Florence is the birthplace of the Renaissance and how these reasons contributed to the Renaissance Current liabilities could include all of the following except: A. any part of long-term debt due during the current period. B. a notes payable due in 9 months. C. a bank loan due in 18 months. D. an accounts payable due in 30 days. A solution is made by mixing 34.5 g of sugar with 75.0 g of water. What is the mass percent of sugar in this solution? Please explain and show work. Write a program that inputs a line of text tokenizing the line with function strtok and outputs the tokens in reverse order i.e. last token in the sentence is printed first and first token is printed last. The user must be able to specify at most 80 characters in the sentence. Help me! Thanks!!!!!! A quantity of ideal gas requires 800 kJ to raise the temperature of the gas by 10.0 K when the gas is maintained at constant volume. The same quantity of gas requires 900 kJ to raise the temperature of the gas by 10.0 K when the gas is maintained at constant pressure. What is the adiabatic gas constant of this gas Greshak Corp. reports the following revenues:2015 $10,000,0002016 $11,250,0002017 $12,500,0002018 $13,500,0002019 $12,750,0002020 $12,900,000What was Greshaks compound annual growth rate (CAGR) in revenues over the 6-year period 2015 through 2020? Lc 7g bn an i t nh n trng vi tc trung bnh l 20km/h . Bn n trng lc 7g20. Tnh khong cch t nh ti trng? In the late nineteenth century, a number of people from European countries moved to the United States. The act of moving to one nation from another is called . BOYS AND GIRLS, HELP ME PLEASE!!5,6,7,8 PLEASEfactor this examples Calculate the numerical value of the equilibrium constant, Kc, for the reaction below if the equilibrium concentrations for CO, H2 , CH4 and H2O are 0.989 M, 0.993 M, 1.078 M and 0.878 M, respectively. (calculate your answer to three sig figs)CO(g) + 3 H2(g) CH4(g) + H2O(g) Which of the following statements is False. A. Correlational research can be used to study naturally occurring variables.B. Correlations tell researchers about the strength and direction of relationships between variables C. Correlations can be used to establish cause-and- effect relationships between variables D. Correlational research can be conducted either in the laboratory or in the field Enter the solutions from least to greatest.f(x) = (x 3)(2x 8) How many electrons will one atom of element with 6 protons and 9 neutrons . give an explanation of tundra sin(180+0).cos(180+0)/cos(180+0).sin(180-0)